Homosalate is a salicylate ester that appears as a viscous, light yellow to slightly tan liquid or oil. It is primarily used as a sunscreen agent in personal care products.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 118-56-9
N-Acetyl-L-glutamic acid
amino acid impurity
Panthenyl ethyl ether acetate
cosmetic ingredient
(3R)-3-Hydroxybutyl (3R)-3-hydroxybutanoate
ketone ester research compound
Roxarsone
veterinary antimicrobial growth promoter
(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate
WSSJONWNBBTCMG-UHFFFAOYSA-N
CC1CC(CC(C1)(C)C)OC(=O)C2=CC=CC=C2O