This compound is a salt-like organoboron reagent, typically supplied as a research chemical. Its structure features a pyrazole ring and a boronate ester moiety, making it of interest for organic synthesis and materials science studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1173889-20-7
3-amino-3-(3-bromophenyl)propanoic acid
Research compound
3-amino-3-(3-fluorophenyl)propanoic acid
chemical compound for research
1,1-Dimethylethyl 4-[[[(1R,2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]oct-2-yl]carbonyl]amino]-1-piperidinecarboxylate
research compound
5-Bromo-6-methyl-3-pyridinecarboxaldehyde
synthetic building block for pharmaceutical research
lithium 4-(2-hydroxy-4,4,5,5-tetramethyl-1,3-dioxa-2-boranuidacyclopent-2-yl)-1-methylpyrazole
YAGHQCJCHREQHW-UHFFFAOYSA-N
[Li+].[B-]1(OC(C(O1)(C)C)(C)C)(C2=CN(N=C2)C)O
—