This compound is a dye intermediate, specifically a benzamido-substituted naphthalene disulfonic acid derivative. It is primarily used in the synthesis of dyes and pigments for industrial applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 117-46-4
1-Naphthol-4,8-disulfonic acid
naphthol disulfonic acid intermediate for dyes
1-Naphthalenesulfonic acid, 5-hydroxy-
Dye intermediate for azo dyes
Benzidine-2,2'-disulfonic acid
Dye intermediate for azo dyes
2-Amino-1,5-naphthalenedisulfonic acid
dye intermediate
4-benzamido-5-hydroxynaphthalene-2,7-disulfonic acid
RKKZDGOUSIOSIY-UHFFFAOYSA-N
C1=CC=C(C=C1)C(=O)NC2=C3C(=CC(=C2)S(=O)(=O)O)C=C(C=C3O)S(=O)(=O)O