Bromamine acid is an intermediate for anthraquinone dyes. It is a sulfonated anthraquinone derivative containing an amino group and a bromine atom, used in the synthesis of various colorants.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 116-81-4
C.I. Acid Blue 1
Acid blue dye for textiles
1-Naphthol-8-sulfonic acid
dye intermediate
1,3,6-Naphthalenetrisulfonic acid, 8-amino-
Dye intermediate
1-Naphthol-3,8-disulfonic acid
Dye intermediate for naphthol sulfonic acids
1-amino-4-bromo-9,10-dioxoanthracene-2-sulfonic acid
QZZSAWGVHXXMID-UHFFFAOYSA-N
C1=CC=C2C(=C1)C(=O)C3=C(C=C(C(=C3C2=O)N)S(=O)(=O)O)Br