7-bromo-1H-indole-3-carbaldehyde is a brominated indole derivative used as a research compound. Its structure features an indole core with a formyl group at the 3-position and a bromine atom at the 7-position, contributing to its utility in synthetic chemistry and biological studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 115666-21-2
Pseudouridine 5'-phosphate
research compound for RNA modification studies
1-Amino-3-phenylnaphthalene
Research compound
1,3-Bis(2,6-di(pentan-3-yl)phenyl)-1H-imidazol-3-ium chloride
research compound for organic synthesis
4-FLUORO-3-NITROPYRIDINE
Organic synthesis intermediate
7-bromo-1H-indole-3-carbaldehyde
MGPMWCBAOQWENZ-UHFFFAOYSA-N
C1=CC2=C(C(=C1)Br)NC=C2C=O