This compound is a polycyclic aromatic diol featuring two bromine substituents and two 9,9-dimethylfluoren-2-yl groups attached to an anthracene-9,10-diol core. Its structure includes multiple aromatic rings and alcohol functional groups, making it a specialized laboratory reagent for organic synthesis and materials research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1154751-56-0
1-Benzyl-N-phenylpiperidin-4-amine
Research reagent for pharmacological studies
N-Carbobenzoxy-L-glutamic acid
Research compound for peptide synthesis
(1R,2S)-2-(3,4-difluorophenyl)cyclopropan-1-amine;hydrochloride
pharmaceutical research compound
(1-aminocyclopropyl)methanol hydrochloride
research compound
2,6-dibromo-9,10-bis(9,9-dimethylfluoren-2-yl)anthracene-9,10-diol
DOVVBLFNAFZXLO-UHFFFAOYSA-N
CC1(C2=CC=CC=C2C3=C1C=C(C=C3)C4(C5=C(C=C(C=C5)Br)C(C6=C4C=C(C=C6)Br)(C7=CC8=C(C=C7)C9=CC=CC=C9C8(C)C)O)O)C
—