This compound is a pharmaceutical intermediate featuring a biphenyl core with a bromomethyl substituent and a tert-butyl ester group. It is primarily relevant in the synthesis of advanced pharmaceutical compounds, particularly those targeting the angiotensin II receptor.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 114772-40-6
2-Cyano-4'-methylbiphenyl
pharmaceutical intermediate
4'-Bromomethyl-2-cyanobiphenyl
Pharmaceutical intermediate
Des[2'-(1H-tetrazol-5-yl)] 2-cyanolosartan
Pharmaceutical intermediate for losartan synthesis
2-Chloro-4-fluoro-5-nitrobenzoic acid
pharmaceutical intermediate for bumetanide
tert-butyl 2-[4-(bromomethyl)phenyl]benzoate
YHXCWNQNVMAENQ-UHFFFAOYSA-N
CC(C)(C)OC(=O)C1=CC=CC=C1C2=CC=C(C=C2)CBr