This compound is a deuterium-labeled research reagent, specifically a bromoiodobenzene derivative with four deuterium atoms replacing hydrogen atoms on the aromatic ring. Its primary significance is as a stable isotope-labeled compound used in analytical and synthetic chemistry research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1147565-46-5
(R)-O-((2,2-Dimethyl-1,3-dioxolan-4-yl)methyl)hydroxylamine
organic synthesis intermediate
4,4,5,5-Tetramethyl-2-(3,3,3-trifluoropropyl)-1,3,2-dioxaborolane
Research reagent for synthetic chemistry
Diethyl 1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylate
Hantzsch ester as redox probe
N-Carbobenzyloxy-L-valine
peptide synthesis reagent
1-Bromo-4-iodobenzene
research reagent for organic synthesis
1-bromo-2,3,5,6-tetradeuterio-4-iodobenzene
UCCUXODGPMAHRL-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1Br)[2H])[2H])I)[2H]