(2H8)Naphthalene is a deuterium-labeled form of naphthalene where all eight hydrogen atoms are replaced by deuterium. It is primarily used as an isotopically labeled reference standard in analytical chemistry and research applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1146-65-2
2,6-Di-iso-propylphenol-d18
isotopically labeled reference standard
4-Acetaminophen-d3 Sulfate Potassium Salt
isotopically labeled reference standard
L-Phenyl-d5-alanine-2,3,3-d3
isotopically labeled reference standard
Acyclovir-d4 L-Leucinate
isotopically labeled reference standard
MMT-Hexylaminolinker Phosphoramidite
oligonucleotide synthesis phosphoramidite reagent
(S)-2-(3-Bromophenyl)propanoic acid
Pharmaceutical intermediate or research compound
3-bromo-6-(trifluoromethyl)imidazo[1,2-a]pyridine
research compound
Adenosine 5'-diphosphate dipotassium salt
Nucleoside Diphosphate Series
1,2,3,4,5,6,7,8-octadeuterionaphthalene
UFWIBTONFRDIAS-PGRXLJNUSA-N
[2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])[2H])[2H])[2H])[2H]