This compound is a chemical compound that serves as a building block for the synthesis of the agrochemical penthiopyrad. It is characterized by a pyrazole ring with a carboxylic acid group and a trifluoromethyl substituent.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 113100-53-1
1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid
FZNKJQNEJGXCJH-UHFFFAOYSA-N
CN1C=C(C(=N1)C(F)(F)F)C(=O)O