This compound is a research reagent designed for supramolecular chemistry, featuring a structure with multiple aromatic and heterocyclic rings that facilitate alkylation of pendant pyridyl groups. It serves as a building block for developing supramolecular architectures through controlled self-assembly processes.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 112881-51-3
D-FMOC-methionine
Protected amino acid for peptide synthesis
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(naphthalen-2-yl)propanoic acid
Research compound for peptide synthesis
Trans-3,4-Difluorocinnamic acid
research compound
(2E)-3-(2,5-difluorophenyl)prop-2-enoic acid
research compound
2,6-dipyridin-2-yl-4-pyridin-4-ylpyridine
DPPKPCLKZOLTMB-UHFFFAOYSA-N
C1=CC=NC(=C1)C2=CC(=CC(=N2)C3=CC=CC=N3)C4=CC=NC=C4
—