Oleoyl chloride is a chemical compound used primarily as a pharmaceutical intermediate in the synthesis of other compounds. It is an acyl chloride derived from oleic acid, characterized by a long hydrocarbon chain and a reactive chlorocarbonyl group.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 112-77-6
Nonanoyl chloride
Acylating agent for chemical synthesis
(2R)-2-(((2R)-1-(Bis(4-methoxyphenyl)(phenyl)methoxy)-3-(((2-cyanoethoxy)(diisopropylamino)phosphino)oxy)propan-2-yl)oxy)-2-(2-isobutyramido-6-oxo-3H-purin-9(6H)-yl)ethyl benzoate
nucleoside phosphoramidite building block
(S)-tetrahydrofuran-3-yl 4-methylbenzenesulfonate
Chiral intermediate for pharmaceutical synthesis
(S)-(-)-alpha,alpha-Diphenyl-2-pyrrolidinemethanol
pharmaceutical intermediate
4-methylpyridin-3-ol
Pharmaceutical intermediate
(Z)-octadec-9-enoyl chloride
MLQBTMWHIOYKKC-KTKRTIGZSA-N
CCCCCCCC/C=C\CCCCCCCC(=O)Cl