Fmoc-Phe-Lys(Trt)-PAB-PNP is a protected amino acid derivative used as a building block in solid-phase peptide synthesis. Its structure incorporates a Fmoc-protected phenylalanine, a trityl-protected lysine, and a PAB-PNP linker, enabling the construction of complex peptide sequences.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1116086-09-9
3-bromoimidazo[1,2-a]pyridine-8-carboxylic acid
Research compound
Methyl 4-bromocrotonate
research compound
2-Bromo-3-fluoroaniline
Research chemical for synthesis
Magnesium bromide 5-chlorothiophen-2-ide (1/1/1)
5-Chloro-2-thienylmagnesium bromide reagent
[4-[[(2S)-1-amino-1-oxo-6-(tritylamino)hexan-2-yl]-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate
LOGURWMJSNXIEZ-YQOHNZFASA-N
C1=CC=C(C=C1)C[C@@H](C(=O)N(C2=CC=C(C=C2)COC(=O)OC3=CC=C(C=C3)[N+](=O)[O-])[C@@H](CCCCNC(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6)C(=O)N)NC(=O)OCC7C8=CC=CC=C8C9=CC=CC=C79