3-Methyl-d3-indole is a deuterated research compound, specifically a trideuteromethyl-labeled derivative of 3-methylindole. Its isotopic labeling makes it useful as an internal standard or tracer in analytical chemistry and metabolic studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 111399-60-1
Ethyl alaninate hydrochloride
research compound for amino acid studies
N-Acetyl-DL-alanine
N-acyl-amino acid reference standard
2-Aminoheptanoic acid
research compound
(6-phenyldibenzo[b,d]thiophen-4-yl)boronic acid
Research compound for organic synthesis
3-(trideuteriomethyl)-1H-indole
ZFRKQXVRDFCRJG-FIBGUPNXSA-N
[2H]C([2H])([2H])C1=CNC2=CC=CC=C21