Ethyl oleate is an ester compound used primarily as a flavoring agent in animal feed. It also serves as a solvent or co-solvent in certain pesticide products.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 111-62-6
Ethyl all cis-7,10,13,16,19-Docosapentaenoate
research compound
Enramycin
Feed additive for poultry and swine
Calcium gluconolactate
calcium supplement
(+-)-Pantothenic acid
Vitamin B5 dietary supplement
N-Acetyl-DL-methionine
nutritional supplement and food additive
ethyl (Z)-octadec-9-enoate
LVGKNOAMLMIIKO-QXMHVHEDSA-N
CCCCCCCC/C=C\CCCCCCCC(=O)OCC