This compound is a phosphoramidite monomer used in the synthesis of oligonucleotides. It features a complex structure with multiple aromatic rings, ether groups, and a nitrile group, making it a specialized reagent for solid-phase DNA/RNA synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 110782-31-5
2'-O-MOE-N6-Benzoyl-Adenosine Phosphoramidite
nucleoside phosphoramidite building block
Bz-rA Phosphoramidite
Phosphoramidite intermediate for oligonucleotide synthesis
N-[9-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-3-fluorooxolan-2-yl]purin-6-yl]benzamide
Pharmaceutical intermediate for oligonucleotide synthesis
(2R,3R,4R,5R)-5-(6-Benzamido-9H-purin-9-yl)-2-((bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-(prop-2-yn-1-yloxy)tetrahydrofuran-3-yl (2-cyanoethyl) diisopropylphosphoramidite
nucleotide phosphoramidite reagent for oligonucleotide synthesis
5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-amine
Pharmaceutical intermediate
4-Chloro-3-fluorobenzonitrile
Pharmaceutical intermediate
Benzyl (2S)-(-)-glycidate
Pharmaceutical intermediate for synthesis
1-برومو الهكسان
manufacture pharmaceuticals and organic chemicals
N-[9-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-3-methoxyoxolan-2-yl]purin-6-yl]benzamide
AZCGOTUYEPXHMJ-PSVHYZMASA-N
CC(C)N(C(C)C)P(OCCC#N)O[C@@H]1[C@H](O[C@H]([C@@H]1OC)N2C=NC3=C(N=CN=C32)NC(=O)C4=CC=CC=C4)COC(C5=CC=CC=C5)(C6=CC=C(C=C6)OC)C7=CC=C(C=C7)OC