This compound is a chiral pharmaceutical intermediate used in the synthesis of Exatecan. It features a complex fused-ring structure with multiple functional groups, including an alcohol, ester, and aromatic ring.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 110351-94-5
((3as,5r,6s,6as)-6-hydroxy-2,2-dimethyltetrahydrofuro[2,3-d][1,3]dioxol-5-yl)(morpholino)methanone
pharmaceutical intermediate
(2-chloro-5-iodophenyl)(4-ethoxyphenyl)methanone
Pharmaceutical intermediate
110428-42-7
steroidal pharmaceutical intermediate
N-Methylparoxetine
Pharmaceutical intermediate for paroxetine
(4S)-4-ethyl-4-hydroxy-7,8-dihydro-1H-pyrano[3,4-f]indolizine-3,6,10-trione
IGKWOGMVAOYVSJ-ZDUSSCGKSA-N
CC[C@@]1(C2=C(COC1=O)C(=O)N3CCC(=O)C3=C2)O