This compound is a pharmaceutical intermediate carrying a chiral secondary amine and a carboxylic acid group, specifically designed for the synthesis of phenylephrine-related molecules. Its structure features a single aromatic ring with both alcohol and acid functional groups, making it a polar, hydrogen-bond-donating building block.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1094089-46-9
N-Fmoc-N'-trityl-L-histidine
Protected amino acid for peptide synthesis
Tert-butyl (3R)-3-hydroxypyrrolidine-1-carboxylate
Pharmaceutical intermediate for API synthesis
Methyl 5-(chlorosulfonyl)-2-fluorobenzoate
Pharmaceutical intermediate
Sildenafil N-Oxide
pharmaceutical impurity reference standard
2-[[(2R)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]acetic acid
HIYGSKMMSXCQJE-JTQLQIEISA-N
CN(C[C@@H](C1=CC(=CC=C1)O)O)CC(=O)O
—