5,12-Naphthacenequinone is a tetracenequinone compound that serves as a quinone intermediate in the production of dyes and pigments.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1090-13-7
1-ethoxycarbonyl-1,1-difluoro-2-butyl methacrylate
monomer for polymer synthesis
Tert-Butyl 2,2-difluoro-3-(methacryloyloxy)pentanoate
Industrial chemical intermediate
FURAN
Chemical intermediate for tetrahydrofuran synthesis
Di-tert-butyl peroxide
Polymerization catalyst and cross-linking agent
tetracene-5,12-dione
LZPBKINTWROMEA-UHFFFAOYSA-N
C1=CC=C2C=C3C(=CC2=C1)C(=O)C4=CC=CC=C4C3=O