Benzyl 2-(difluoromethoxy)acetate is a chemical compound featuring an ester functional group, an aromatic ring, and two halogen atoms. It is primarily used in research and chemical manufacturing as a synthetic intermediate.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1089709-30-7
benzyl 2-(difluoromethoxy)acetate
RYKKJPDBCIAJIB-UHFFFAOYSA-N
C1=CC=C(C=C1)COC(=O)COC(F)F
—