Phenylacetic-2,2-d2 acid is a deuterated form of phenylacetic acid, specifically labeled with two deuterium atoms at the alpha position. It is primarily used as a research standard in analytical chemistry and metabolic studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1076-07-9
4-Hydroxycoumarin
Chemical research reagent
Perdeuterobenzene
NMR solvent and reference standard
Methyl 6-bromo-1H-indole-4-carboxylate
research compound
Amyloid beta 1-42
research compound for Alzheimer's disease
Phenylacetic-d7 acid
deuterated standard for analytical chemistry
PHENYLACETIC ACID
Perfume and flavoring agent
2,2-dideuterio-2-phenylacetic acid
WLJVXDMOQOGPHL-NCYHJHSESA-N
[2H]C([2H])(C1=CC=CC=C1)C(=O)O