2,4-Dimethyl-5-nitropyridine is a research compound with a pyridine ring framework substituted with methyl and nitro groups. It is primarily used as a laboratory reagent for chemical synthesis and research applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1074-99-3
4-(6-Methoxynaphthalen-2-yl)benzoic acid
pharmaceutical impurity reference standard
4-Vinylbenzoic acid
Building block for polymer synthesis
3-bromobenzylmagnesium bromide
Grignard reagent for organic synthesis
4-Ethylphenylboronic acid pinacol ester
Boronic acid ester for Suzuki coupling
2,4-dimethyl-5-nitropyridine
GMAJNANLBOHCAU-UHFFFAOYSA-N
CC1=CC(=NC=C1[N+](=O)[O-])C