2-Bromo-2'-chloro-1,1'-biphenyl is a halogenated biphenyl compound consisting of a bromine atom on one benzene ring and a chlorine atom on the adjacent ring. It has a nonpolar structure with two aromatic rings and one rotatable bond, giving it low polarity and high lipophilicity.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 107208-70-8
1-bromo-2-(2-chlorophenyl)benzene
JSVXIWLDFVOHBB-UHFFFAOYSA-N
C1=CC=C(C(=C1)C2=CC=CC=C2Br)Cl