4-Fluorobenzoyl-d4 chloride is a deuterium-labeled research compound in which the four hydrogen atoms on the aromatic ring are replaced by deuterium. It is primarily used as a stable isotope-labeled building block for analytical and synthetic chemistry applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1071809-52-3
1,4-Dimethylpyrazole
research compound
1H-Imidazole-4-carboxylic acid
research compound
2,6-DICHLOROPYRIDINE-4-BORONIC ACID
boronic acid building block
2,6-Dimethylpyridine N-oxide
Research compound
4-Fluorobenzoyl chloride
precursor to high-performance polymer PEEK
2,3,5,6-tetradeuterio-4-fluorobenzoyl chloride
CZKLEJHVLCMVQR-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1C(=O)Cl)[2H])[2H])F)[2H]