Granisetron Impurity B is a chemical compound used as a pharmaceutical intermediate. It is primarily employed in the manufacturing of granisetron-related products.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 107007-95-4
Tert-butyl N-[1-(hydroxymethyl)cyclopropyl]carbamate
peptide synthesis protecting group intermediate
(s)-azetidine-1,2-dicarboxylic acid 1-tert-butyl ester 2-methyl ester
Pharmaceutical intermediate for peptide synthesis
4-[[6-chloro-2-[(4-cyanophenyl)amino]-4-pyrimidinyl]oxy]-3,5-dimethylbenzonitrile
Pharmaceutical intermediate for impurity synthesis
Cyclopropanamine, 2-(phenyl-d5)-, hydrochloride, trans-
deuterated pharmaceutical reference standard
BRL 43694A
Pharmaceutical active ingredient
N-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)-1H-indazole-3-carboxamide
GHVQAOGYNZNTIA-UHFFFAOYSA-N
CN1C2CCCC1CC(C2)NC(=O)C3=NNC4=CC=CC=C43