Sodium bis(trimethylsilyl)amide is a strong base commonly used in chemical synthesis as a laboratory reagent. It is a salt-like compound composed of a sodium cation and a bis(trimethylsilyl)amide anion, typically handled under inert conditions due to its reactivity with moisture.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1070-89-9
Potassium bis(trimethylsilyl)amide
strong non-nucleophilic base
BrettPhos
phosphine ligand for cross-coupling reactions
2,5-Dimethoxyphenylboronic acid
Research reagent for organic synthesis
S-Ethylisothiourea hydrobromide
Research compound for chemical synthesis
5-bromo-3,4-dimethylbenzene-1,2-diamine
research compound
sodium bis(trimethylsilyl)azanide
WRIKHQLVHPKCJU-UHFFFAOYSA-N
C[Si](C)(C)[N-][Si](C)(C)C.[Na+]