This compound is a deuterated form of isopropylamine, where all seven hydrogen atoms in the methyl groups and the methine position are replaced with deuterium. It is primarily used as a research reagent in studies involving isotopic labeling.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 106658-09-7
Iso-Propyl-d7-amine HCl
Research compound with deuterium labeling
(S)-Ru(OAc)2(T-BINAP)
chiral catalyst for asymmetric synthesis
Isopropylmagnesium Chloride
Grignard reagent for organic synthesis
Aminomalonic acid
metabolite research reagent
(S)-morpholine-3-carboxylic acid
research compound
ISO-PROPYL-1,1,1,3,3,3-D6-AMINE
deuterated research reagent
2-Propanamine
Solvent and chemical intermediate
1,1,1,2,3,3,3-heptadeuteriopropan-2-amine
JJWLVOIRVHMVIS-YYWVXINBSA-N
[2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])N