4-Butoxyphenylboronic acid is a boronic acid derivative used as a research chemical. Its structure features an aromatic ring with a butoxy substituent, contributing to its properties for laboratory applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 105365-51-3
4'-Pentyloxybiphenyl-4-boronic Acid
pharmaceutical intermediate
N-Nitroso Cilazapril
Nitrosamine impurity standard
1,2-Dimyristoyl-sn-glycero-3-phospho-L-serine sodium salt
phospholipid research reagent
4-(Methylamino)benzoic acid
research reagent
PRO-LYS-LYS-LYS-ARG-LYS-VAL-GLU-ASP-*PRO-TYR-CYS
research compound
(4-butoxyphenyl)boronic acid
QUPFQMXWFNJUNJ-UHFFFAOYSA-N
B(C1=CC=C(C=C1)OCCCC)(O)O