4-Methoxymandelic acid is a chemical intermediate used in the production of vanillylmandelic acid. Vanillylmandelic acid is an intermediate in the synthesis of artificial vanilla flavorings and is also the end-stage metabolite of catecholamines.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 10502-44-0
Fmoc-L-lysine
Protected amino acid for peptide synthesis
2-Cyanoethyl 2-(4-cyano-2-methoxybenzylidene)-3-oxobutanoate
Pharmaceutical intermediate for finerenone
2-Cyanoethyl 4-(4-cyano-2-methoxyphenyl)-2,8-dimethyl-5-oxo-1,4,5,6-tetrahydro-1,6-naphthyridine-3-carboxylate
pharmaceutical intermediate
2-cyanoethyl 4-(4-cyano-2-methoxyphenyl)-5-ethoxy-2,8-dimethyl-1,4-dihydro-1,6-naphthyridine-3-carboxylate
pharmaceutical intermediate
D-4-Methoxymandelic acid
research compound
(2S)-2-hydroxy-2-(4-methoxyphenyl)acetic acid
research reference standard
2-hydroxy-2-(4-methoxyphenyl)acetic acid
ITECRQOOEQWFPE-UHFFFAOYSA-N
COC1=CC=C(C=C1)C(C(=O)O)O