Benzylbis(2-chloroethyl)amine hydrochloride is a chemical compound used as a pharmaceutical intermediate, primarily in the synthesis of nitrogen mustard derivatives. It features a benzyl group and two chloroethyl chains, and is commonly supplied as a hydrochloride salt for manufacturing and research applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 10429-82-0
D-Homoserine Lactone hydrochloride
pharmaceutical intermediate
N-[9-[(2R,6S)-6-[[chloro(dimethylamino)phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]-6-oxo-1H-purin-2-yl]-2-phenylacetamide
Pharmaceutical intermediate for oligonucleotide synthesis
(R)-1-Cbz-3-aminopiperidine
Pharmaceutical intermediate
2-Aminoethylmethylsulfone hydrochloride
pharmaceutical intermediate
N-benzyl-2-chloro-N-(2-chloroethyl)ethanamine;hydrochloride
AZRWNJFEUSHORT-UHFFFAOYSA-N
C1=CC=C(C=C1)CN(CCCl)CCCl.Cl