3,5-Diiodo-L-thyronine is a chemical compound used as a pharmaceutical intermediate in the synthesis of thyroid hormones. It is structurally related to triiodothyronine (T3), a naturally occurring thyroid hormone that influences metabolism, growth, and development.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1041-01-6
ليفوثيروكسين
active pharmaceutical ingredient
Tert-Butyl 2,6-diazaspiro[3.3]heptane-2-carboxylate hemioxalate
Pharmaceutical intermediate
[(4-Chlorobenzoyl)oxy]acetic acid
pharmaceutical intermediate for acemetacin
GCLE
Cephalosporin intermediate for antibiotic synthesis
DODMA
Lipid nanoparticle component for drug delivery
(2S)-2-amino-3-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]propanoic acid
ZHSOTLOTTDYIIK-ZDUSSCGKSA-N
C1=CC(=CC=C1O)OC2=C(C=C(C=C2I)C[C@@H](C(=O)O)N)I