4-Methoxy-3-nitrobenzoyl chloride is a research reagent and chemical intermediate used primarily in organic synthesis. It features a benzoyl chloride moiety substituted with methoxy and nitro groups, making it a versatile building block for preparing more complex molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 10397-28-1
4-Methyl-1-naphthaleneboronic acid
boronic acid research reagent
4-Nitrophenylacetic acid
organic synthesis reagent
2-Hydroxy-4-(trifluoromethyl)pyrimidine
research compound
3-Methoxynaphthalene-2-boronic acid
research compound
4-methoxy-3-nitrobenzoyl chloride
FUXMQFBGQSNVBM-UHFFFAOYSA-N
COC1=C(C=C(C=C1)C(=O)Cl)[N+](=O)[O-]
—