2-Benzamido-4-mercaptobutanoic acid is a research compound featuring a benzamide group linked to a thiol-containing butanoic acid backbone. Its structure includes an amide, a carboxylic acid, and a thiol group, making it useful as a building block in peptide and intermediate synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 103796-22-1
1-Nitrosopiperidin-4-yl)diphenylmethanol
Nitrosamine impurity reference standard
4,4'-Diaminooctafluorobiphenyl
research compound for structural studies
4,4'-Dibromooctafluorobiphenyl
Research compound for crystallography studies
3-(3,4-dichlorophenyl)pentanedioic acid
research compound
2-benzamido-4-sulfanylbutanoic acid
ZQQSNOCMNFNYHN-UHFFFAOYSA-N
C1=CC=C(C=C1)C(=O)NC(CCS)C(=O)O