2-Aminoterephthalic acid is a research compound used primarily in materials science and chemistry. It features both carboxylic acid and amine functional groups on an aromatic ring, making it useful for synthesizing coordination polymers and other advanced materials.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 10312-55-7
Methyl 1-benzylpiperidine-4-carboxylate
research compound
DL-Cysteine hydrochloride
research compound
(2,5-Dibromopyridin-4-yl)boronic acid
chemical synthesis intermediate
Phenobarbital N-?-D-Glucuronide
Pharmaceutical impurity reference standard
2-aminoterephthalic acid
GPNNOCMCNFXRAO-UHFFFAOYSA-N
C1=CC(=C(C=C1C(=O)O)N)C(=O)O