Ethyl 4-(diethylamino)benzoate is an organic compound featuring an ester group attached to an aromatic ring with a diethylamino substituent. Its structure combines an aromatic ring, an amine, and an ester functional group, contributing to its moderate lipophilicity and low molecular weight.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 10287-54-4
ethyl 4-(diethylamino)benzoate
XPKFLEVLLPKCIW-UHFFFAOYSA-N
CCN(CC)C1=CC=C(C=C1)C(=O)OCC