3-(Trifluoromethoxy)benzoic acid is a chemical compound featuring a benzoic acid core with a trifluoromethoxy substituent. It is primarily used as an intermediate in the synthesis of active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1014-81-9
6-Chloro-5-nitro-1H-indazole
Pharmaceutical intermediate
Tert-butyl (3S)-3-hydroxypyrrolidine-1-carboxylate
Pharmaceutical intermediate for drug synthesis
5-Chloro-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid
pharmaceutical intermediate
Hydroxy Dimetridazole-d3
Pharmaceutical intermediate and reference standard
3-(trifluoromethoxy)benzoic acid
OKPFIWIMBJNFSE-UHFFFAOYSA-N
C1=CC(=CC(=C1)OC(F)(F)F)C(=O)O