This compound is a potassium salt of a trifluoroborate-substituted pyrazole, typically used as a chemical research reagent. It features an aromatic heterocycle with a borate group and exists as a salt-like form.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1013640-87-3
4-Hydroxycoumarin
Chemical research reagent
2,4,5-Trifluoro-3-hydroxybenzoic acid
Chemical research reagent
1H-indazole-6-carbonitrile
Chemical research reagent
4-Methoxyphenylhydrazine hydrochloride
Chemical research reagent
2-bromo-5-chlorothiophene-3-carbaldehyde
research compound
Sudan III-d6
Deuterated analytical reference standard
1'-Acetoxy Midazolam N2-?-D-glucuronide
reference standard compound
1-Boc-4-PIPERIDONE-2,2,6,6-D4
deuterated research reagent
potassium trifluoro(1H-pyrazol-5-yl)boranuide
QNHYBMZHGRWURK-UHFFFAOYSA-N
[B-](C1=CC=NN1)(F)(F)F.[K+]
—