This compound is an anionic naphthalene sulfonate salt used as a fluorescent probe and assay reagent in biochemical research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 100900-07-0
N1-(4-bromophenyl)-1,2-benzenediamine
research compound
2-BENZYLPYRIDINE
inducer of hepatic microsomal cytochrome P450
(6-Phenyldibenzo[b,d]furan-4-yl)boronic acid
Boronic acid building block for synthesis
2-Chloro-5-thiazolecarboxylic acid
research compound for synthetic chemistry
sodium 5-(2-aminoethylamino)naphthalene-1-sulfonate
HGWRACRQRUQQGH-UHFFFAOYSA-M
C1=CC2=C(C=CC=C2S(=O)(=O)[O-])C(=C1)NCCN.[Na+]