Sodium 2-formylbenzenesulfonate is a chemical compound used as an intermediate in the manufacture of non-food pesticide products. It features an aromatic ring with sulfonate and formyl functional groups, typically supplied as a salt form for industrial applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1008-72-6
4,4'-Bis(alpha,alpha-dimethylbenzyl)diphenylamine
Antioxidant and heat stabilizer
3,5-dichloro-4-methylpyridine
industrial chemical intermediate
4'-Hydroxybutyrophenone
chemical intermediate for organic synthesis
Isopropyl 3-bromopropanoate
chemical intermediate for synthesis
sodium 2-formylbenzenesulfonate
ADPUQRRLAAPXGT-UHFFFAOYSA-M
C1=CC=C(C(=C1)C=O)S(=O)(=O)[O-].[Na+]