This compound is a pharmaceutical intermediate, specifically a chiral alcohol bearing chlorine and fluorine substituents on an aromatic ring. It is primarily used in the synthesis of other chemical compounds for pharmaceutical research and manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1006376-60-8
(1R,2R)-2-(3,4-Difluorophenyl)cyclopropanecarboxamide
Pharmaceutical intermediate
(2S)-2-(3,4-difluorophenyl)oxirane
Pharmaceutical intermediate
1-(3-Bromo-4-fluorophenyl)ethanone
pharmaceutical intermediate
3-Bromo-4-fluorobenzoic acid
Pharmaceutical intermediate for synthesis
(1S)-2-chloro-1-(3,4-difluorophenyl)ethanol
RYOLLNVCYSUXCP-MRVPVSSYSA-N
C1=CC(=C(C=C1[C@@H](CCl)O)F)F