Barium nitrate is an inorganic salt composed of barium and nitrate ions. It is a colorless, toxic, and water-soluble solid that burns with a green flame and serves as an oxidizer, making it valuable in pyrotechnics.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 10022-31-8
Europium Nitrate Hexahydrate
rare earth metal intermediate
Bismuth nitrate pentahydrate
synthesis of other bismuth compounds
STRONTIUM NITRATE
oxidizer and colorant in pyrotechnics
Palladium nitrate
Catalyst for chemical reactions
Guanidinium bicarbonate
carbonate salt of guanidine
Platinum dichloride
catalyst for oxidative chlorination of alkanes
SULFUR MONOCHLORIDE
vulcanizing rubber and chemical synthesis
Tin dichloride dihydrate
Reducing agent and tin-plating electrolyte
barium(2+) dinitrate
IWOUKMZUPDVPGQ-UHFFFAOYSA-N
[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Ba+2]