Tegobuvir is a chemical compound used as a non-structural protein 5B polymerase inhibitor in pharmaceutical manufacturing. It is an imidazopyridine derivative with a complex heterocyclic structure, typically supplied as a research compound or intermediate.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1000787-75-6
Tivantinib
c-Met inhibitor
BMS 754807
insulin-like growth factor 1 receptor inhibitor
7-chloro-1-[2-(ethylamino)ethyl]-5-(2-fluorophenyl)-4,5-dihydro-3H-1,4-benzodiazepin-2-one
active pharmaceutical ingredient
Nitrous oxide
anesthetic in dentistry and surgery
5-[[6-[2,4-bis(trifluoromethyl)phenyl]pyridazin-3-yl]methyl]-2-(2-fluorophenyl)imidazo[4,5-c]pyridine
XBEQSQDCBSKCHJ-UHFFFAOYSA-N
C1=CC=C(C(=C1)C2=NC3=CN(C=CC3=N2)CC4=NN=C(C=C4)C5=C(C=C(C=C5)C(F)(F)F)C(F)(F)F)F