Fructosylvaline is a small-molecule research compound belonging to the class of fructosamines, formed through the non-enzymatic glycation of the amino acid valine with fructose. It is primarily used as a standard or reference material in studies investigating the Maillard reaction and advanced glycation end-products (AGEs) in food chemistry and biomedical research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 10003-64-2
3-Fluoro-2-nitrobenzoic acid
research compound
3,5-dibromo-2-fluoro-4-methylpyridine
research compound
3-Bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine
Research reagent
1,4-Piperazinediethanesulfonic acid sesquisodium salt
buffering agent in biochemistry
(2S)-3-methyl-2-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]butanoic acid
JEQHVKBNRPNQDY-UTINFBMNSA-N
CC(C)[C@@H](C(=O)O)NCC(=O)[C@H]([C@@H]([C@@H](CO)O)O)O