4-Nitrophenol is a phenolic compound with a nitro group positioned opposite the hydroxyl group on the benzene ring. It serves as an intermediate in the production of insecticides and dyes.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 100-02-7
4-Nitrobenzyl chloride
chemical intermediate for synthesis
Terephthaloyl chloride
Intermediate for synthetic fibers and resins
ديثيلثانولامين
chemical intermediate for pharmaceuticals and industrial chemicals
Phenylethane
intermediate for styrene production
Sodium 4-nitrophenolate
Intermediate for pesticide production
Phen-2,3,5,6-d4-ol, 4-nitro-
deuterated research compound
4-nitrophenol
BTJIUGUIPKRLHP-UHFFFAOYSA-N
C1=CC(=CC=C1[N+](=O)[O-])O