This compound is a chiral phosphine ligand used in asymmetric catalysis. It features a binaphthyl backbone with multiple aromatic rings and zero polar surface area, reflecting its nonpolar character.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 99646-28-3
2,2'-Bis(di-p-tolylphosphino)-1,1'-binaphthyl
chiral phosphine ligand for catalysis
[RUCL(P-CYMENE)((R)-TOLBINAP)]CL
asymmetric hydrogenation catalyst
(S)-Ru(OAc)2(T-BINAP)
chiral catalyst for asymmetric synthesis
(S)-Ru(OAc)2(T-BINAP)
asymmetric hydrogenation catalyst
Chloro[(S)-2,2'-bis(bis(3,5-dimethylphenyl)phosphino)-1,1'-binaphthyl](p-cymene)ruthenium(II) chloride
asymmetric hydrogenation catalyst
(R)-[2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl dichlororuthenium
asymmetric hydrogenation catalyst
(S)-RuCl[(p-cymene(BINAP)Cl
asymmetric hydrogenation catalyst
(S)-(+)-1-[(R)-2-(DICYCLOHEXYLPHOSPHINO)FERROCENYL]ETHYLDIPHENYLPHOSPHINE
chiral phosphine ligand for asymmetric catalysis
[1-[2-bis(4-methylphenyl)phosphanylnaphthalen-1-yl]naphthalen-2-yl]-bis(4-methylphenyl)phosphane
IOPQYDKQISFMJI-UHFFFAOYSA-N
CC1=CC=C(C=C1)P(C2=CC=C(C=C2)C)C3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)P(C7=CC=C(C=C7)C)C8=CC=C(C=C8)C