This compound is a chiral phosphine ligand used in catalytic applications. It is a research reagent designed for use in asymmetric catalysis, where it coordinates to metals to facilitate stereoselective reactions.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 100165-88-6
[RUCL(P-CYMENE)((R)-TOLBINAP)]CL
asymmetric hydrogenation catalyst
(S)-Ru(OAc)2(T-BINAP)
chiral catalyst for asymmetric synthesis
(S)-Ru(OAc)2(T-BINAP)
asymmetric hydrogenation catalyst
Chloro((S)-(-)-2,2'-bis(di-p-tolylphosphino)-1,1'-binaphthyl)(p-cymene)ruthenium(II) chloride (RuCl(p-cymene)((S)-tolbinap))Cl
Asymmetric hydrogenation catalyst
(R)-(+)-2,2'-BIS[DI(3,5-XYLYL)PHOSPHINO]-1,1'-BINAPHTHYL
chiral phosphine ligand for catalysis
(R,R)-2,7-DI-TERT-BUTYL-9,9-DIMETHYL-4,5-BIS(METHYLPHENYLPHOSPHINO)XANTHENE
chiral phosphine ligand for catalysis
8-Aminooctanoic acid
research reagent for expanded genetic code
1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate)
phosphonium salt reagent
[1-[2-bis(4-methylphenyl)phosphanylnaphthalen-1-yl]naphthalen-2-yl]-bis(4-methylphenyl)phosphane
IOPQYDKQISFMJI-UHFFFAOYSA-N
CC1=CC=C(C=C1)P(C2=CC=C(C=C2)C)C3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)P(C7=CC=C(C=C7)C)C8=CC=C(C=C8)C