Ni-(S)-BPB-GLy is a nickel-coordinated research compound featuring a chiral (S)-BPB ligand and a glycine-derived moiety. It is primarily utilized in laboratory studies of nickel coordination chemistry.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 96293-19-5
3-Nitrophthalamide
Research chemical intermediate
3-bromo-5-chloroaniline
research compound
4-Nitrophenyl 4,6-ethylidene-a-D-maltoheptaoside
chromogenic substrate for enzyme assays
3-(3,6-Bis(2-hydroxyethyl)pyrazin-2-yl)propanoic acid
research compound
[N-[Phenyl[2-[[[(1S,2R)-1-(phenylmethyl)-2-pyrrolidinyl-|EN]carbonyl]amino-|EN]phenyl]methylene]glycinato(2-)-|EN,|EO]nickel
research compound
[(2S)-1-benzylpyrrolidine-2-carbonyl]-[2-[N-(carboxymethyl)-C-phenylcarbonimidoyl]phenyl]azanide;nickel
DRZQCPMTUIIOMU-JIDHJSLPSA-M
C1C[C@H](N(C1)CC2=CC=CC=C2)C(=O)[N-]C3=CC=CC=C3C(=NCC(=O)O)C4=CC=CC=C4.[Ni]