3-Nitrophthalamide is a chemical compound featuring a benzene ring substituted with two amide groups and a nitro group. It serves as a research chemical intermediate in laboratory and industrial settings.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 96385-50-1
3-bromo-5-chloroaniline
research compound
4-Nitrophenyl 4,6-ethylidene-a-D-maltoheptaoside
chromogenic substrate for enzyme assays
3-(3,6-Bis(2-hydroxyethyl)pyrazin-2-yl)propanoic acid
research compound
3-Methoxy-4-hydroxyphenylethylamine hydrochloride
research compound
3-nitrobenzene-1,2-dicarboxamide
GMOAOEGBMSRFFQ-UHFFFAOYSA-N
C1=CC(=C(C(=C1)[N+](=O)[O-])C(=O)N)C(=O)N