This compound is a salt-like research reagent consisting of a boroxine derivative coordinated with pyridine. It is primarily used in boroxine chemistry for laboratory studies and material synthesis.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 95010-17-6
L-Serine-d2
isotopically labeled research compound
1,2-Ethanediol, 1,1,2-triphenyl-, 2-acetate, (2S)-
research compound
Ethyl 5-(hydroxymethyl)-3-phenylisoxazole-4-carboxylate
research compound
Magnesium bromide 3-methylthiophen-2-ide (1/1/1)
research reagent for synthesis
pyridine;2,4,6-tris(ethenyl)-1,3,5,2,4,6-trioxatriborinane
YLHJACXHRQQNQR-UHFFFAOYSA-N
B1(OB(OB(O1)C=C)C=C)C=C.C1=CC=NC=C1