L-Serine-d2 is a isotopically labeled research compound, specifically a deuterated form of the amino acid L-serine. It is primarily used as an internal standard or tracer in laboratory studies, particularly in metabolic and analytical research.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 95034-57-4
2-NP-SCA 13C,15N2
isotopically labeled research compound
Nitrobenzene-(1)(3)C
isotopically labeled research compound
2,4,6-Trichlorophen-3,5-d2-ol
isotopically labeled research compound
P,p'-DDD-d8
isotopically labeled research compound
1,2-Ethanediol, 1,1,2-triphenyl-, 2-acetate, (2S)-
research compound
Ethyl 5-(hydroxymethyl)-3-phenylisoxazole-4-carboxylate
research compound
Magnesium bromide 3-methylthiophen-2-ide (1/1/1)
research reagent for synthesis
Acetophenone, 2-phenyl-, oxime
research compound
(2S)-2-amino-3,3-dideuterio-3-hydroxypropanoic acid
MTCFGRXMJLQNBG-XFJCSJJYSA-N
[2H]C([2H])([C@@H](C(=O)O)N)O